C15H11FN2O2S — CID 35874940
3-fluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide (PubChem CID 35874940) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-fluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide.
| Compound Name | 3-fluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide |
|---|---|
| PubChem CID | 35874940 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-fluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3cccc(F)c3)cc2N1 |
| InChI | InChI=1S/C15H11FN2O2S/c16-10-3-1-2-9(6-10)15(20)17-11-4-5-13-12(7-11)18-14(19)8-21-13/h1-7H,8H2,(H,17,20)(H,18,19) |
| InChIKey | UXVLUNTZYFMJNG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |