C21H16N2O3S — CID 35875024
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenoxybenzamide (PubChem CID 35875024) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenoxybenzamide.
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenoxybenzamide |
|---|---|
| PubChem CID | 35875024 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-phenoxybenzamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3cccc(Oc4ccccc4)c3)cc2N1 |
| InChI | InChI=1S/C21H16N2O3S/c24-20-13-27-19-10-9-15(12-18(19)23-20)22-21(25)14-5-4-8-17(11-14)26-16-6-2-1-3-7-16/h1-12H,13H2,(H,22,25)(H,23,24) |
| InChIKey | LROAULLBVKJUKN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |