C18H15N3O3S — CID 167886727
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(prop-2-enoylamino)benzamide (PubChem CID 167886727) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(prop-2-enoylamino)benzamide.
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 167886727 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-3-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)Nc2ccc3c(c2)NC(=O)CS3)c1 |
| InChI | InChI=1S/C18H15N3O3S/c1-2-16(22)19-12-5-3-4-11(8-12)18(24)20-13-6-7-15-14(9-13)21-17(23)10-25-15/h2-9H,1,10H2,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | QBVLBQYQPNFOIT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|