C14H11N3O3S — CID 103763504
2-oxo-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyridine-4-carboxamide (PubChem CID 103763504) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-oxo-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyridine-4-carboxamide.
| Compound Name | 2-oxo-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103763504 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-oxo-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyridine-4-carboxamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3cc[nH]c(=O)c3)cc2N1 |
| InChI | InChI=1S/C14H11N3O3S/c18-12-5-8(3-4-15-12)14(20)16-9-1-2-11-10(6-9)17-13(19)7-21-11/h1-6H,7H2,(H,15,18)(H,16,20)(H,17,19) |
| InChIKey | VYPJONNVVICZPI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |