C21H19N3O2S — CID 31722234
4-(2,5-dimethylpyrrol-1-yl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide (PubChem CID 31722234) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide |
|---|---|
| PubChem CID | 31722234 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)Nc2ccc3c(c2)NC(=O)CS3)cc1 |
| InChI | InChI=1S/C21H19N3O2S/c1-13-3-4-14(2)24(13)17-8-5-15(6-9-17)21(26)22-16-7-10-19-18(11-16)23-20(25)12-27-19/h3-11H,12H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | WIDXTPFALYXVBH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|