C18H17N3O3S — CID 55753946
N-[4-(ethylcarbamoyl)phenyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 55753946) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[4-(ethylcarbamoyl)phenyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[4-(ethylcarbamoyl)phenyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 55753946 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[4-(ethylcarbamoyl)phenyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)c2ccc3c(c2)NC(=O)CS3)cc1 |
| InChI | InChI=1S/C18H17N3O3S/c1-2-19-17(23)11-3-6-13(7-4-11)20-18(24)12-5-8-15-14(9-12)21-16(22)10-25-15/h3-9H,2,10H2,1H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | JHWOYZNTARSALB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |