C15H10F2N2O2S — CID 37015355
2,5-difluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide (PubChem CID 37015355) has the molecular formula C15H10F2N2O2S and a molecular weight of 320.32 g/mol. Its IUPAC name is 2,5-difluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide.
| Compound Name | 2,5-difluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide |
|---|---|
| PubChem CID | 37015355 |
| Molecular Formula | C15H10F2N2O2S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2,5-difluoro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)benzamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3cc(F)ccc3F)cc2N1 |
| InChI | InChI=1S/C15H10F2N2O2S/c16-8-1-3-11(17)10(5-8)15(21)18-9-2-4-13-12(6-9)19-14(20)7-22-13/h1-6H,7H2,(H,18,21)(H,19,20) |
| InChIKey | DVZHBUYSYFTODQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |