C22H15F3N2O2S — CID 37015144
N-(3-oxo-4H-1,4-benzothiazin-6-yl)-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 37015144) has the molecular formula C22H15F3N2O2S and a molecular weight of 428.44 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 37015144 |
| Molecular Formula | C22H15F3N2O2S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2N1 |
| InChI | InChI=1S/C22H15F3N2O2S/c23-22(24,25)14-7-5-13(6-8-14)16-3-1-2-4-17(16)21(29)26-15-9-10-19-18(11-15)27-20(28)12-30-19/h1-11H,12H2,(H,26,29)(H,27,28) |
| InChIKey | OTBRRCBBGLLFSZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |