C13H9ClN4O2S — CID 61041116
6-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyridazine-3-carboxamide (PubChem CID 61041116) has the molecular formula C13H9ClN4O2S and a molecular weight of 320.76 g/mol. Its IUPAC name is 6-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 61041116 |
| Molecular Formula | C13H9ClN4O2S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 6-chloro-N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyridazine-3-carboxamide |
| SMILES | O=C1CSc2ccc(NC(=O)c3ccc(Cl)nn3)cc2N1 |
| InChI | InChI=1S/C13H9ClN4O2S/c14-11-4-2-8(17-18-11)13(20)15-7-1-3-10-9(5-7)16-12(19)6-21-10/h1-5H,6H2,(H,15,20)(H,16,19) |
| InChIKey | LSVZVAZFKSRJRQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |