C15H11N3O3S2 — CID 110759482
N-(4-cyanophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 110759482) has the molecular formula C15H11N3O3S2 and a molecular weight of 345.41 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | N-(4-cyanophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 110759482 |
| Molecular Formula | C15H11N3O3S2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | N-(4-cyanophenyl)-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)CS3)cc1 |
| InChI | InChI=1S/C15H11N3O3S2/c16-8-10-1-3-11(4-2-10)18-23(20,21)12-5-6-14-13(7-12)17-15(19)9-22-14/h1-7,18H,9H2,(H,17,19) |
| InChIKey | PHXNPQJAEZCRQI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |