C17H18N2O3S2 — CID 22550030
3-oxo-N-(2,4,6-trimethylphenyl)-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 22550030) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 3-oxo-N-(2,4,6-trimethylphenyl)-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 3-oxo-N-(2,4,6-trimethylphenyl)-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 22550030 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-oxo-N-(2,4,6-trimethylphenyl)-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc3c(c2)NC(=O)CS3)c(C)c1 |
| InChI | InChI=1S/C17H18N2O3S2/c1-10-6-11(2)17(12(3)7-10)19-24(21,22)13-4-5-15-14(8-13)18-16(20)9-23-15/h4-8,19H,9H2,1-3H3,(H,18,20) |
| InChIKey | IZWIISBOUUZGMF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |