C12H12N4O3S2 — CID 61274772
5-methyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 61274772) has the molecular formula C12H12N4O3S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is 5-methyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61274772 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 5-methyl-N-(3-oxo-4H-1,4-benzothiazin-6-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C12H12N4O3S2/c1-7-11(5-13-15-7)21(18,19)16-8-2-3-10-9(4-8)14-12(17)6-20-10/h2-5,16H,6H2,1H3,(H,13,15)(H,14,17) |
| InChIKey | PQKJIUCOZAPJDJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |