C16H16N2O3S2 — CID 110784806
2-methyl-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]benzenesulfonamide (PubChem CID 110784806) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-methyl-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]benzenesulfonamide.
| Compound Name | 2-methyl-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110784806 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-methyl-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C16H16N2O3S2/c1-11-4-2-3-5-15(11)23(20,21)17-9-12-6-7-14-13(8-12)18-16(19)10-22-14/h2-8,17H,9-10H2,1H3,(H,18,19) |
| InChIKey | KMSQQJZUEQHGMS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |