C10H12N4O2S — CID 115192676
1-amino-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea (PubChem CID 115192676) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-amino-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea.
| Compound Name | 1-amino-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea |
|---|---|
| PubChem CID | 115192676 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-amino-3-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]urea |
| SMILES | NNC(=O)NCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C10H12N4O2S/c11-14-10(16)12-4-6-1-2-8-7(3-6)13-9(15)5-17-8/h1-3H,4-5,11H2,(H,13,15)(H2,12,14,16) |
| InChIKey | JBYAZPLVHGMBHY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|