C12H15N3O2S — CID 115152395
2-amino-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide (PubChem CID 115152395) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-amino-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide.
| Compound Name | 2-amino-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide |
|---|---|
| PubChem CID | 115152395 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-amino-N-[(3-oxo-4H-1,4-benzothiazin-6-yl)methyl]propanamide |
| SMILES | CC(N)C(=O)NCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C12H15N3O2S/c1-7(13)12(17)14-5-8-2-3-10-9(4-8)15-11(16)6-18-10/h2-4,7H,5-6,13H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | RDLKHXAARXQGDX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |