C11H13N3O2S — CID 115259923
2-[(3-oxo-4H-1,4-benzothiazin-6-yl)methylamino]acetamide (PubChem CID 115259923) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-[(3-oxo-4H-1,4-benzothiazin-6-yl)methylamino]acetamide.
| Compound Name | 2-[(3-oxo-4H-1,4-benzothiazin-6-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 115259923 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[(3-oxo-4H-1,4-benzothiazin-6-yl)methylamino]acetamide |
| SMILES | NC(=O)CNCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H13N3O2S/c12-10(15)5-13-4-7-1-2-9-8(3-7)14-11(16)6-17-9/h1-3,13H,4-6H2,(H2,12,15)(H,14,16) |
| InChIKey | JPTUUPJQOUITLX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |