C12H16N2O3S — CID 115122131
6-[(2,3-dihydroxypropylamino)methyl]-4H-1,4-benzothiazin-3-one (PubChem CID 115122131) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 6-[(2,3-dihydroxypropylamino)methyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[(2,3-dihydroxypropylamino)methyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115122131 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 6-[(2,3-dihydroxypropylamino)methyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(CNCC(O)CO)cc2N1 |
| InChI | InChI=1S/C12H16N2O3S/c15-6-9(16)5-13-4-8-1-2-11-10(3-8)14-12(17)7-18-11/h1-3,9,13,15-16H,4-7H2,(H,14,17) |
| InChIKey | GEHMUTYFVAZGOR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |