C11H15N3OS — CID 115195329
6-[(2-aminoethylamino)methyl]-4H-1,4-benzothiazin-3-one (PubChem CID 115195329) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 6-[(2-aminoethylamino)methyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[(2-aminoethylamino)methyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115195329 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 6-[(2-aminoethylamino)methyl]-4H-1,4-benzothiazin-3-one |
| SMILES | NCCNCc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H15N3OS/c12-3-4-13-6-8-1-2-10-9(5-8)14-11(15)7-16-10/h1-2,5,13H,3-4,6-7,12H2,(H,14,15) |
| InChIKey | AMIMXMDAVTWDAU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|