C12H16N2O3S2 — CID 126458806
N-butyl-3-oxo-4H-1,4-benzothiazine-7-sulfonamide (PubChem CID 126458806) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N-butyl-3-oxo-4H-1,4-benzothiazine-7-sulfonamide.
| Compound Name | N-butyl-3-oxo-4H-1,4-benzothiazine-7-sulfonamide |
|---|---|
| PubChem CID | 126458806 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-butyl-3-oxo-4H-1,4-benzothiazine-7-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2c(c1)SCC(=O)N2 |
| InChI | InChI=1S/C12H16N2O3S2/c1-2-3-6-13-19(16,17)9-4-5-10-11(7-9)18-8-12(15)14-10/h4-5,7,13H,2-3,6,8H2,1H3,(H,14,15) |
| InChIKey | JCLXXHOMSZQENZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|