C13H18N2O4S — CID 110759072
N-butyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-sulfonamide (PubChem CID 110759072) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-butyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-sulfonamide.
| Compound Name | N-butyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-sulfonamide |
|---|---|
| PubChem CID | 110759072 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-butyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc2c(c1)NC(=O)CCO2 |
| InChI | InChI=1S/C13H18N2O4S/c1-2-3-7-14-20(17,18)10-4-5-12-11(9-10)15-13(16)6-8-19-12/h4-5,9,14H,2-3,6-8H2,1H3,(H,15,16) |
| InChIKey | YQKBJRLYJFAXBG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|