C12H17N3O4S — CID 63732434
N-(2-aminobutyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 63732434) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(2-aminobutyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-(2-aminobutyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 63732434 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(2-aminobutyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | CCC(N)CNS(=O)(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C12H17N3O4S/c1-2-8(13)6-14-20(17,18)9-3-4-11-10(5-9)15-12(16)7-19-11/h3-5,8,14H,2,6-7,13H2,1H3,(H,15,16) |
| InChIKey | UDCKTAMKFJRPDN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |