C11H15N3O4S — CID 62658542
N-[2-(methylamino)ethyl]-3-oxo-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 62658542) has the molecular formula C11H15N3O4S and a molecular weight of 285.33 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-oxo-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-[2-(methylamino)ethyl]-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 62658542 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | CNCCNS(=O)(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C11H15N3O4S/c1-12-4-5-13-19(16,17)8-2-3-10-9(6-8)14-11(15)7-18-10/h2-3,6,12-13H,4-5,7H2,1H3,(H,14,15) |
| InChIKey | DTYKXEIGGJKBIL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|