C11H13N3O6S — CID 18270098
ethyl N-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]carbamate (PubChem CID 18270098) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is ethyl N-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]carbamate.
| Compound Name | ethyl N-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 18270098 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | ethyl N-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C11H13N3O6S/c1-2-19-11(16)13-14-21(17,18)7-3-4-9-8(5-7)12-10(15)6-20-9/h3-5,14H,2,6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | SECSXYWYCWMSLL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|