C14H12N4O5S — CID 16615764
N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyridine-2-carbohydrazide (PubChem CID 16615764) has the molecular formula C14H12N4O5S and a molecular weight of 348.34 g/mol. Its IUPAC name is N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 16615764 |
| Molecular Formula | C14H12N4O5S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyridine-2-carbohydrazide |
| SMILES | O=C1COc2ccc(S(=O)(=O)NNC(=O)c3ccccn3)cc2N1 |
| InChI | InChI=1S/C14H12N4O5S/c19-13-8-23-12-5-4-9(7-11(12)16-13)24(21,22)18-17-14(20)10-3-1-2-6-15-10/h1-7,18H,8H2,(H,16,19)(H,17,20) |
| InChIKey | XBRKJFCCMTZLIC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|