C15H12N2O6S — CID 18230441
3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]benzoic acid (PubChem CID 18230441) has the molecular formula C15H12N2O6S and a molecular weight of 348.34 g/mol. Its IUPAC name is 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 18230441 |
| Molecular Formula | C15H12N2O6S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]benzoic acid |
| SMILES | O=C1COc2ccc(S(=O)(=O)Nc3cccc(C(=O)O)c3)cc2N1 |
| InChI | InChI=1S/C15H12N2O6S/c18-14-8-23-13-5-4-11(7-12(13)16-14)24(21,22)17-10-3-1-2-9(6-10)15(19)20/h1-7,17H,8H2,(H,16,18)(H,19,20) |
| InChIKey | CMZNGUVUGDMYPB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |