C20H16N2O5S — CID 51335151
3-oxo-N-(3-phenoxyphenyl)-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 51335151) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 3-oxo-N-(3-phenoxyphenyl)-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | 3-oxo-N-(3-phenoxyphenyl)-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 51335151 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-oxo-N-(3-phenoxyphenyl)-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | O=C1COc2ccc(S(=O)(=O)Nc3cccc(Oc4ccccc4)c3)cc2N1 |
| InChI | InChI=1S/C20H16N2O5S/c23-20-13-26-19-10-9-17(12-18(19)21-20)28(24,25)22-14-5-4-8-16(11-14)27-15-6-2-1-3-7-15/h1-12,22H,13H2,(H,21,23) |
| InChIKey | HKEUAVGZLGFFTE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |