C16H16N4O5S — CID 46518720
1-methyl-3-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]phenyl]urea (PubChem CID 46518720) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is 1-methyl-3-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]phenyl]urea.
| Compound Name | 1-methyl-3-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 46518720 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-methyl-3-[4-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonylamino]phenyl]urea |
| SMILES | CNC(=O)Nc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)CO3)cc1 |
| InChI | InChI=1S/C16H16N4O5S/c1-17-16(22)18-10-2-4-11(5-3-10)20-26(23,24)12-6-7-14-13(8-12)19-15(21)9-25-14/h2-8,20H,9H2,1H3,(H,19,21)(H2,17,18,22) |
| InChIKey | JVOIKICAJRGULT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |