C14H11N3O6S — CID 16615772
N-(3-nitrophenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 16615772) has the molecular formula C14H11N3O6S and a molecular weight of 349.32 g/mol. Its IUPAC name is N-(3-nitrophenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-(3-nitrophenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 16615772 |
| Molecular Formula | C14H11N3O6S |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-(3-nitrophenyl)-3-oxo-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | O=C1COc2ccc(S(=O)(=O)Nc3cccc([N+](=O)[O-])c3)cc2N1 |
| InChI | InChI=1S/C14H11N3O6S/c18-14-8-23-13-5-4-11(7-12(13)15-14)24(21,22)16-9-2-1-3-10(6-9)17(19)20/h1-7,16H,8H2,(H,15,18) |
| InChIKey | JBGGXEHJQOOLRH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|