C14H13BrN4O5S — CID 16615874
4-bromo-1-methyl-N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyrrole-2-carbohydrazide (PubChem CID 16615874) has the molecular formula C14H13BrN4O5S and a molecular weight of 429.25 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 16615874 |
| Molecular Formula | C14H13BrN4O5S |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 4-bromo-1-methyl-N'-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]pyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNS(=O)(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H13BrN4O5S/c1-19-6-8(15)4-11(19)14(21)17-18-25(22,23)9-2-3-12-10(5-9)16-13(20)7-24-12/h2-6,18H,7H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | FPOUEKHZUICHIV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|