C16H16N4O7S — CID 30766383
2-[6-[[(1-methylpyrrole-2-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 30766383) has the molecular formula C16H16N4O7S and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-[6-[[(1-methylpyrrole-2-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[6-[[(1-methylpyrrole-2-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 30766383 |
| Molecular Formula | C16H16N4O7S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-[6-[[(1-methylpyrrole-2-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | Cn1cccc1C(=O)NNS(=O)(=O)c1ccc2c(c1)N(CC(=O)O)C(=O)CO2 |
| InChI | InChI=1S/C16H16N4O7S/c1-19-6-2-3-11(19)16(24)17-18-28(25,26)10-4-5-13-12(7-10)20(8-15(22)23)14(21)9-27-13/h2-7,18H,8-9H2,1H3,(H,17,24)(H,22,23) |
| InChIKey | PMRYDTMQCWRREW-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|