C21H21N5O7S — CID 30867393
2-[6-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 30867393) has the molecular formula C21H21N5O7S and a molecular weight of 487.49 g/mol. Its IUPAC name is 2-[6-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[6-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 30867393 |
| Molecular Formula | C21H21N5O7S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-[6-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | CCn1c(C)nc2cc(C(=O)NNS(=O)(=O)c3ccc4c(c3)N(CC(=O)O)C(=O)CO4)ccc21 |
| InChI | InChI=1S/C21H21N5O7S/c1-3-25-12(2)22-15-8-13(4-6-16(15)25)21(30)23-24-34(31,32)14-5-7-18-17(9-14)26(10-20(28)29)19(27)11-33-18/h4-9,24H,3,10-11H2,1-2H3,(H,23,30)(H,28,29) |
| InChIKey | WCEFAFURAHHUFI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|