C19H20N4O5S — CID 31699528
methyl 3-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]benzoate (PubChem CID 31699528) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is methyl 3-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]benzoate.
| Compound Name | methyl 3-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 31699528 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl 3-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]sulfamoyl]benzoate |
| SMILES | CCn1c(C)nc2cc(C(=O)NNS(=O)(=O)c3cccc(C(=O)OC)c3)ccc21 |
| InChI | InChI=1S/C19H20N4O5S/c1-4-23-12(2)20-16-11-13(8-9-17(16)23)18(24)21-22-29(26,27)15-7-5-6-14(10-15)19(25)28-3/h5-11,22H,4H2,1-3H3,(H,21,24) |
| InChIKey | QFPYIZWQLQWYMM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|