C19H19IN4O2 — CID 39707198
1-ethyl-N'-(2-iodo-3-methylbenzoyl)-2-methylbenzimidazole-5-carbohydrazide (PubChem CID 39707198) has the molecular formula C19H19IN4O2 and a molecular weight of 462.29 g/mol. Its IUPAC name is 1-ethyl-N'-(2-iodo-3-methylbenzoyl)-2-methylbenzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-N'-(2-iodo-3-methylbenzoyl)-2-methylbenzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 39707198 |
| Molecular Formula | C19H19IN4O2 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 1-ethyl-N'-(2-iodo-3-methylbenzoyl)-2-methylbenzimidazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)c3cccc(C)c3I)ccc21 |
| InChI | InChI=1S/C19H19IN4O2/c1-4-24-12(3)21-15-10-13(8-9-16(15)24)18(25)22-23-19(26)14-7-5-6-11(2)17(14)20/h5-10H,4H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | WMBCJHUYBQEORE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|