C23H27N5O4S — CID 2465145
1-ethyl-2-methyl-N'-(3-piperidin-1-ylsulfonylbenzoyl)benzimidazole-5-carbohydrazide (PubChem CID 2465145) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N'-(3-piperidin-1-ylsulfonylbenzoyl)benzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-2-methyl-N'-(3-piperidin-1-ylsulfonylbenzoyl)benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2465145 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 1-ethyl-2-methyl-N'-(3-piperidin-1-ylsulfonylbenzoyl)benzimidazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)c3cccc(S(=O)(=O)N4CCCCC4)c3)ccc21 |
| InChI | InChI=1S/C23H27N5O4S/c1-3-28-16(2)24-20-15-18(10-11-21(20)28)23(30)26-25-22(29)17-8-7-9-19(14-17)33(31,32)27-12-5-4-6-13-27/h7-11,14-15H,3-6,12-13H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | FIFLHFIICXETPP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|