C23H28N4O4S — CID 37475473
methyl 4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylamino]benzoate (PubChem CID 37475473) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is methyl 4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylamino]benzoate.
| Compound Name | methyl 4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 37475473 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | methyl 4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylamino]benzoate |
| SMILES | CCn1c(CNc2ccc(C(=O)OC)cc2)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H28N4O4S/c1-3-27-21-12-11-19(32(29,30)26-13-5-4-6-14-26)15-20(21)25-22(27)16-24-18-9-7-17(8-10-18)23(28)31-2/h7-12,15,24H,3-6,13-14,16H2,1-2H3 |
| InChIKey | YVYTVSXUWKVXBU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |