C19H28N4O2S2 — CID 56524886
4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]thiomorpholine (PubChem CID 56524886) has the molecular formula C19H28N4O2S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]thiomorpholine.
| Compound Name | 4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 56524886 |
| Molecular Formula | C19H28N4O2S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]thiomorpholine |
| SMILES | CCn1c(CN2CCSCC2)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C19H28N4O2S2/c1-2-23-18-7-6-16(27(24,25)22-8-4-3-5-9-22)14-17(18)20-19(23)15-21-10-12-26-13-11-21/h6-7,14H,2-5,8-13,15H2,1H3 |
| InChIKey | JRCLJTCPLIJTPJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |