C21H31N5O3S — CID 42914016
1-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]piperidine-2-carboxamide (PubChem CID 42914016) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is 1-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]piperidine-2-carboxamide.
| Compound Name | 1-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 42914016 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]piperidine-2-carboxamide |
| SMILES | CCn1c(CN2CCCCC2C(N)=O)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C21H31N5O3S/c1-2-26-18-10-9-16(30(28,29)25-12-5-3-6-13-25)14-17(18)23-20(26)15-24-11-7-4-8-19(24)21(22)27/h9-10,14,19H,2-8,11-13,15H2,1H3,(H2,22,27) |
| InChIKey | ICCZZDCYUMUWIN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |