C23H30N4O2S2 — CID 55849723
1-ethyl-5-piperidin-1-ylsulfonyl-2-[(2-thiophen-3-ylpyrrolidin-1-yl)methyl]benzimidazole (PubChem CID 55849723) has the molecular formula C23H30N4O2S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 1-ethyl-5-piperidin-1-ylsulfonyl-2-[(2-thiophen-3-ylpyrrolidin-1-yl)methyl]benzimidazole.
| Compound Name | 1-ethyl-5-piperidin-1-ylsulfonyl-2-[(2-thiophen-3-ylpyrrolidin-1-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 55849723 |
| Molecular Formula | C23H30N4O2S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 1-ethyl-5-piperidin-1-ylsulfonyl-2-[(2-thiophen-3-ylpyrrolidin-1-yl)methyl]benzimidazole |
| SMILES | CCn1c(CN2CCCC2c2ccsc2)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H30N4O2S2/c1-2-27-22-9-8-19(31(28,29)26-12-4-3-5-13-26)15-20(22)24-23(27)16-25-11-6-7-21(25)18-10-14-30-17-18/h8-10,14-15,17,21H,2-7,11-13,16H2,1H3 |
| InChIKey | WECNOQQBZDEIGH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |