C19H27N3O4S2 — CID 40685208
ethyl 2-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylsulfanyl]acetate (PubChem CID 40685208) has the molecular formula C19H27N3O4S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is ethyl 2-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 40685208 |
| Molecular Formula | C19H27N3O4S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | ethyl 2-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCc1nc2cc(S(=O)(=O)N3CCCCC3)ccc2n1CC |
| InChI | InChI=1S/C19H27N3O4S2/c1-3-22-17-9-8-15(28(24,25)21-10-6-5-7-11-21)12-16(17)20-18(22)13-27-14-19(23)26-4-2/h8-9,12H,3-7,10-11,13-14H2,1-2H3 |
| InChIKey | ZXGVNTFANFPQKY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |