C22H27N5O4S2 — CID 16519296
(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 16519296) has the molecular formula C22H27N5O4S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is (1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | (1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 16519296 |
| Molecular Formula | C22H27N5O4S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCc2nc3cc(S(=O)(=O)N4CCCCC4)ccc3n2CC)cs1 |
| InChI | InChI=1S/C22H27N5O4S2/c1-3-10-23-22-25-18(15-32-22)21(28)31-14-20-24-17-13-16(8-9-19(17)27(20)4-2)33(29,30)26-11-6-5-7-12-26/h3,8-9,13,15H,1,4-7,10-12,14H2,2H3,(H,23,25) |
| InChIKey | ORSQTVWCMJIJFW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|