C21H23ClN4O5S — CID 24531252
(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-amino-3-chlorobenzoate (PubChem CID 24531252) has the molecular formula C21H23ClN4O5S and a molecular weight of 478.96 g/mol. Its IUPAC name is (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-amino-3-chlorobenzoate.
| Compound Name | (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 24531252 |
| Molecular Formula | C21H23ClN4O5S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-amino-3-chlorobenzoate |
| SMILES | CCn1c(COC(=O)c2cccc(Cl)c2N)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H23ClN4O5S/c1-2-26-18-7-6-14(32(28,29)25-8-10-30-11-9-25)12-17(18)24-19(26)13-31-21(27)15-4-3-5-16(22)20(15)23/h3-7,12H,2,8-11,13,23H2,1H3 |
| InChIKey | TUSWXBDZUXMSLZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|