C21H27N5O7S — CID 42983213
(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 42983213) has the molecular formula C21H27N5O7S and a molecular weight of 493.54 g/mol. Its IUPAC name is (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 42983213 |
| Molecular Formula | C21H27N5O7S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCn1c(COC(=O)CN2C(=O)NC(C)(C)C2=O)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H27N5O7S/c1-4-25-16-6-5-14(34(30,31)24-7-9-32-10-8-24)11-15(16)22-17(25)13-33-18(27)12-26-19(28)21(2,3)23-20(26)29/h5-6,11H,4,7-10,12-13H2,1-3H3,(H,23,29) |
| InChIKey | DOJGRRBPUHIJBA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|