C23H24FN3O5S — CID 31633063
(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 31633063) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 31633063 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)methyl (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | CCn1c(COC(=O)/C=C/c2ccc(F)cc2)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C23H24FN3O5S/c1-2-27-21-9-8-19(33(29,30)26-11-13-31-14-12-26)15-20(21)25-22(27)16-32-23(28)10-5-17-3-6-18(24)7-4-17/h3-10,15H,2,11-14,16H2,1H3/b10-5+ |
| InChIKey | YCDUNAGCOOOTJC-BJMVGYQFSA-N |
| XLogP | 2.97 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|