C19H22N4O5S2 — CID 55312180
[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 55312180) has the molecular formula C19H22N4O5S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55312180 |
| Molecular Formula | C19H22N4O5S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)cs1 |
| InChI | InChI=1S/C19H22N4O5S2/c1-2-8-20-19-21-16(14-29-19)18(25)28-13-17(24)22-9-11-23(12-10-22)30(26,27)15-6-4-3-5-7-15/h2-7,14H,1,8-13H2,(H,20,21) |
| InChIKey | PUDPXSNFUFYYFK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|