C16H22N4O5S — CID 7469022
[2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 7469022) has the molecular formula C16H22N4O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 7469022 |
| Molecular Formula | C16H22N4O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [2-(4-ethoxycarbonylpiperazin-1-yl)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCC(=O)N2CCN(C(=O)OCC)CC2)cs1 |
| InChI | InChI=1S/C16H22N4O5S/c1-3-5-17-15-18-12(11-26-15)14(22)25-10-13(21)19-6-8-20(9-7-19)16(23)24-4-2/h3,11H,1,4-10H2,2H3,(H,17,18) |
| InChIKey | YMNMTIUCMFJFQW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|