C11H15N3O3S — CID 2642372
[2-(ethylamino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 2642372) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 2642372 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCC(=O)NCC)cs1 |
| InChI | InChI=1S/C11H15N3O3S/c1-3-5-13-11-14-8(7-18-11)10(16)17-6-9(15)12-4-2/h3,7H,1,4-6H2,2H3,(H,12,15)(H,13,14) |
| InChIKey | BOXTWPNCHGMJAQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|