C20H23Cl2N3O3S — CID 16519381
[2-[2-(2,4-dichlorophenyl)pentylamino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 16519381) has the molecular formula C20H23Cl2N3O3S and a molecular weight of 456.40 g/mol. Its IUPAC name is [2-[2-(2,4-dichlorophenyl)pentylamino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-[2-(2,4-dichlorophenyl)pentylamino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 16519381 |
| Molecular Formula | C20H23Cl2N3O3S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [2-[2-(2,4-dichlorophenyl)pentylamino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCC(=O)NCC(CCC)c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C20H23Cl2N3O3S/c1-3-5-13(15-7-6-14(21)9-16(15)22)10-24-18(26)11-28-19(27)17-12-29-20(25-17)23-8-4-2/h4,6-7,9,12-13H,2-3,5,8,10-11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | YZTLNEWZAADQMI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|