C13H18N4O4S — CID 16519382
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 16519382) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 16519382 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OC(C)C(=O)NC(=O)NCC)cs1 |
| InChI | InChI=1S/C13H18N4O4S/c1-4-6-15-13-16-9(7-22-13)11(19)21-8(3)10(18)17-12(20)14-5-2/h4,7-8H,1,5-6H2,2-3H3,(H,15,16)(H2,14,17,18,20) |
| InChIKey | AYSOPHQCTGVFAJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|