C15H16N4O5S2 — CID 16519309
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 16519309) has the molecular formula C15H16N4O5S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 16519309 |
| Molecular Formula | C15H16N4O5S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCC(=O)Nc2cccc(S(N)(=O)=O)c2)cs1 |
| InChI | InChI=1S/C15H16N4O5S2/c1-2-6-17-15-19-12(9-25-15)14(21)24-8-13(20)18-10-4-3-5-11(7-10)26(16,22)23/h2-5,7,9H,1,6,8H2,(H,17,19)(H,18,20)(H2,16,22,23) |
| InChIKey | WVXIXRAVBDYNAN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|