C19H22N4O6S2 — CID 16519439
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 16519439) has the molecular formula C19H22N4O6S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 16519439 |
| Molecular Formula | C19H22N4O6S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCC(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cs1 |
| InChI | InChI=1S/C19H22N4O6S2/c1-2-6-20-19-22-16(13-30-19)18(25)29-12-17(24)21-14-4-3-5-15(11-14)31(26,27)23-7-9-28-10-8-23/h2-5,11,13H,1,6-10,12H2,(H,20,22)(H,21,24) |
| InChIKey | LPIQTFPUCVYPRJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|